C8H10N2O4 — CID 18955472
2-(2,3,4,5-tetrahydroxyphenyl)ethanimidamide (PubChem CID 18955472) has the molecular formula C8H10N2O4 and a molecular weight of 198.18 g/mol. Its IUPAC name is 2-(2,3,4,5-tetrahydroxyphenyl)ethanimidamide.
| Compound Name | 2-(2,3,4,5-tetrahydroxyphenyl)ethanimidamide |
|---|---|
| PubChem CID | 18955472 |
| Molecular Formula | C8H10N2O4 |
| Molecular Weight | 198.18 g/mol |
| Exact Mass | 198.06 |
| IUPAC Name | 2-(2,3,4,5-tetrahydroxyphenyl)ethanimidamide |
| SMILES | [H]/N=C(\N)Cc1cc(O)c(O)c(O)c1O |
| InChI | InChI=1S/C8H10N2O4/c9-5(10)2-3-1-4(11)7(13)8(14)6(3)12/h1,11-14H,2H2,(H3,9,10) |
| InChIKey | RCHHRIUYCSMBRD-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 130.79 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.18 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|