C13H12O6 — CID 139941734
5-[(2,4,5-trihydroxyphenyl)methyl]benzene-1,2,3-triol (PubChem CID 139941734) has the molecular formula C13H12O6 and a molecular weight of 264.23 g/mol. Its IUPAC name is 5-[(2,4,5-trihydroxyphenyl)methyl]benzene-1,2,3-triol.
| Compound Name | 5-[(2,4,5-trihydroxyphenyl)methyl]benzene-1,2,3-triol |
|---|---|
| PubChem CID | 139941734 |
| Molecular Formula | C13H12O6 |
| Molecular Weight | 264.23 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | 5-[(2,4,5-trihydroxyphenyl)methyl]benzene-1,2,3-triol |
| SMILES | Oc1cc(O)c(Cc2cc(O)c(O)c(O)c2)cc1O |
| InChI | InChI=1S/C13H12O6/c14-8-5-10(16)9(15)4-7(8)1-6-2-11(17)13(19)12(18)3-6/h2-5,14-19H,1H2 |
| InChIKey | BBZCJXVASMDNPJ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.23 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|