C8H8BrCl2NO — CID 141473932
2-(4-amino-2-bromo-3,5-dichlorophenyl)ethanol (PubChem CID 141473932) has the molecular formula C8H8BrCl2NO and a molecular weight of 284.97 g/mol. Its IUPAC name is 2-(4-amino-2-bromo-3,5-dichlorophenyl)ethanol.
| Compound Name | 2-(4-amino-2-bromo-3,5-dichlorophenyl)ethanol |
|---|---|
| PubChem CID | 141473932 |
| Molecular Formula | C8H8BrCl2NO |
| Molecular Weight | 284.97 g/mol |
| Exact Mass | 282.92 |
| IUPAC Name | 2-(4-amino-2-bromo-3,5-dichlorophenyl)ethanol |
| SMILES | Nc1c(Cl)cc(CCO)c(Br)c1Cl |
| InChI | InChI=1S/C8H8BrCl2NO/c9-6-4(1-2-13)3-5(10)8(12)7(6)11/h3,13H,1-2,12H2 |
| InChIKey | JFVAZYDKXJKVBZ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.97 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|