C6H3BrCl3N — CID 14898479
3-bromo-2,4,6-trichloroaniline (PubChem CID 14898479) has the molecular formula C6H3BrCl3N and a molecular weight of 275.36 g/mol. Its IUPAC name is 3-bromo-2,4,6-trichloroaniline.
| Compound Name | 3-bromo-2,4,6-trichloroaniline |
|---|---|
| PubChem CID | 14898479 |
| Molecular Formula | C6H3BrCl3N |
| Molecular Weight | 275.36 g/mol |
| Exact Mass | 272.85 |
| IUPAC Name | 3-bromo-2,4,6-trichloroaniline |
| SMILES | Nc1c(Cl)cc(Cl)c(Br)c1Cl |
| InChI | InChI=1S/C6H3BrCl3N/c7-4-2(8)1-3(9)6(11)5(4)10/h1H,11H2 |
| InChIKey | JGCNVHHYSUWLNT-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.36 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|