C8H11ClN2O — CID 10197983
2-(2,5-diamino-4-chlorophenyl)ethanol (PubChem CID 10197983) has the molecular formula C8H11ClN2O and a molecular weight of 186.64 g/mol. Its IUPAC name is 2-(2,5-diamino-4-chlorophenyl)ethanol.
| Compound Name | 2-(2,5-diamino-4-chlorophenyl)ethanol |
|---|---|
| PubChem CID | 10197983 |
| Molecular Formula | C8H11ClN2O |
| Molecular Weight | 186.64 g/mol |
| Exact Mass | 186.06 |
| IUPAC Name | 2-(2,5-diamino-4-chlorophenyl)ethanol |
| SMILES | Nc1cc(CCO)c(N)cc1Cl |
| InChI | InChI=1S/C8H11ClN2O/c9-6-4-7(10)5(1-2-12)3-8(6)11/h3-4,12H,1-2,10-11H2 |
| InChIKey | IRPQBHDXFZCQCZ-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.64 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|