C20H22Cl2N4 — CID 159824858
4-[2-(4-aminophenyl)ethyl]aniline;2,5-dichlorobenzene-1,4-diamine (PubChem CID 159824858) has the molecular formula C20H22Cl2N4 and a molecular weight of 389.33 g/mol. Its IUPAC name is 4-[2-(4-aminophenyl)ethyl]aniline;2,5-dichlorobenzene-1,4-diamine.
| Compound Name | 4-[2-(4-aminophenyl)ethyl]aniline;2,5-dichlorobenzene-1,4-diamine |
|---|---|
| PubChem CID | 159824858 |
| Molecular Formula | C20H22Cl2N4 |
| Molecular Weight | 389.33 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | 4-[2-(4-aminophenyl)ethyl]aniline;2,5-dichlorobenzene-1,4-diamine |
| SMILES | Nc1cc(Cl)c(N)cc1Cl.Nc1ccc(CCc2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C14H16N2.C6H6Cl2N2/c15-13-7-3-11(4-8-13)1-2-12-5-9-14(16)10-6-12;7-3-1-5(9)4(8)2-6(3)10/h3-10H,1-2,15-16H2;1-2H,9-10H2 |
| InChIKey | NMRZPBFPRQTEDK-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.33 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|