About bis(4-chlorobenzene-1,3-diamine);hydrate
bis(4-chlorobenzene-1,3-diamine);hydrate (PubChem CID 174419312) has the molecular formula C12H16Cl2N4O
and a molecular weight of 303.19 g/mol. Its IUPAC name is bis(4-chlorobenzene-1,3-diamine);hydrate.
Molecular Properties
| Compound Name | bis(4-chlorobenzene-1,3-diamine);hydrate |
| PubChem CID | 174419312 |
| Molecular Formula | C12H16Cl2N4O |
| Molecular Weight | 303.19 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | bis(4-chlorobenzene-1,3-diamine);hydrate |
| SMILES | Nc1ccc(Cl)c(N)c1.Nc1ccc(Cl)c(N)c1.O |
| InChI | InChI=1S/2C6H7ClN2.H2O/c2*7-5-2-1-4(8)3-6(5)9;/h2*1-3H,8-9H2;1H2 |
| InChIKey | ZZWBAXKCFWURKW-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 135.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.19 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze bis(4-chlorobenzene-1,3-diamine);hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(4-chlorobenzene-1,3-diamine);hydrate?
The IUPAC name of bis(4-chlorobenzene-1,3-diamine);hydrate (CID 174419312) is bis(4-chlorobenzene-1,3-diamine);hydrate.
What is the SMILES notation for bis(4-chlorobenzene-1,3-diamine);hydrate?
The canonical SMILES for bis(4-chlorobenzene-1,3-diamine);hydrate is Nc1ccc(Cl)c(N)c1.Nc1ccc(Cl)c(N)c1.O.
What is the InChIKey of bis(4-chlorobenzene-1,3-diamine);hydrate?
The InChIKey is ZZWBAXKCFWURKW-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H7ClN2.H2O/c2*7-5-2-1-4(8)3-6(5)9;/h2*1-3H,8-9H2;1H2.
What are the key properties of bis(4-chlorobenzene-1,3-diamine);hydrate?
bis(4-chlorobenzene-1,3-diamine);hydrate has a molecular weight of 303.19 g/mol, XLogP of 2.18, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(4-chlorobenzene-1,3-diamine);hydrate is sourced from PubChem (CID 174419312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).