About 5-amino-2-chlorobenzoyl chloride
5-amino-2-chlorobenzoyl chloride (PubChem CID 86092283) has the molecular formula C7H5Cl2NO
and a molecular weight of 190.03 g/mol. Its IUPAC name is 5-amino-2-chlorobenzoyl chloride.
Molecular Properties
| Compound Name | 5-amino-2-chlorobenzoyl chloride |
| PubChem CID | 86092283 |
| Molecular Formula | C7H5Cl2NO |
| Molecular Weight | 190.03 g/mol |
| Exact Mass | 188.97 |
| IUPAC Name | 5-amino-2-chlorobenzoyl chloride |
| SMILES | Nc1ccc(Cl)c(C(=O)Cl)c1 |
| InChI | InChI=1S/C7H5Cl2NO/c8-6-2-1-4(10)3-5(6)7(9)11/h1-3H,10H2 |
| InChIKey | UJWDJWHRWHPTBY-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.03 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-2-chlorobenzoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-2-chlorobenzoyl chloride?
The IUPAC name of 5-amino-2-chlorobenzoyl chloride (CID 86092283) is 5-amino-2-chlorobenzoyl chloride.
What is the SMILES notation for 5-amino-2-chlorobenzoyl chloride?
The canonical SMILES for 5-amino-2-chlorobenzoyl chloride is Nc1ccc(Cl)c(C(=O)Cl)c1.
What is the InChIKey of 5-amino-2-chlorobenzoyl chloride?
The InChIKey is UJWDJWHRWHPTBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5Cl2NO/c8-6-2-1-4(10)3-5(6)7(9)11/h1-3H,10H2.
What are the key properties of 5-amino-2-chlorobenzoyl chloride?
5-amino-2-chlorobenzoyl chloride has a molecular weight of 190.03 g/mol, XLogP of 2.30, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-2-chlorobenzoyl chloride is sourced from PubChem (CID 86092283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).