C12H8Cl4N2O — CID 20555108
4-(4-amino-2,5-dichlorophenoxy)-2,5-dichloroaniline (PubChem CID 20555108) has the molecular formula C12H8Cl4N2O and a molecular weight of 338.02 g/mol. Its IUPAC name is 4-(4-amino-2,5-dichlorophenoxy)-2,5-dichloroaniline.
| Compound Name | 4-(4-amino-2,5-dichlorophenoxy)-2,5-dichloroaniline |
|---|---|
| PubChem CID | 20555108 |
| Molecular Formula | C12H8Cl4N2O |
| Molecular Weight | 338.02 g/mol |
| Exact Mass | 335.94 |
| IUPAC Name | 4-(4-amino-2,5-dichlorophenoxy)-2,5-dichloroaniline |
| SMILES | Nc1cc(Cl)c(Oc2cc(Cl)c(N)cc2Cl)cc1Cl |
| InChI | InChI=1S/C12H8Cl4N2O/c13-5-3-11(7(15)1-9(5)17)19-12-4-6(14)10(18)2-8(12)16/h1-4H,17-18H2 |
| InChIKey | FKMXGRMLZQGNNE-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.02 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|