C12H9Cl3N2O — CID 106748304
4-(2,4,5-trichlorophenoxy)benzene-1,2-diamine (PubChem CID 106748304) has the molecular formula C12H9Cl3N2O and a molecular weight of 303.58 g/mol. Its IUPAC name is 4-(2,4,5-trichlorophenoxy)benzene-1,2-diamine.
| Compound Name | 4-(2,4,5-trichlorophenoxy)benzene-1,2-diamine |
|---|---|
| PubChem CID | 106748304 |
| Molecular Formula | C12H9Cl3N2O |
| Molecular Weight | 303.58 g/mol |
| Exact Mass | 301.98 |
| IUPAC Name | 4-(2,4,5-trichlorophenoxy)benzene-1,2-diamine |
| SMILES | Nc1ccc(Oc2cc(Cl)c(Cl)cc2Cl)cc1N |
| InChI | InChI=1S/C12H9Cl3N2O/c13-7-4-9(15)12(5-8(7)14)18-6-1-2-10(16)11(17)3-6/h1-5H,16-17H2 |
| InChIKey | QKSLLZKOFRFMOL-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.58 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|