C17H21ClN2O3 — CID 143445579
4-[2-chloro-4-(1,3-dioxolan-2-yl)phenoxy]benzene-1,2-diamine;ethane (PubChem CID 143445579) has the molecular formula C17H21ClN2O3 and a molecular weight of 336.82 g/mol. Its IUPAC name is 4-[2-chloro-4-(1,3-dioxolan-2-yl)phenoxy]benzene-1,2-diamine;ethane.
| Compound Name | 4-[2-chloro-4-(1,3-dioxolan-2-yl)phenoxy]benzene-1,2-diamine;ethane |
|---|---|
| PubChem CID | 143445579 |
| Molecular Formula | C17H21ClN2O3 |
| Molecular Weight | 336.82 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | 4-[2-chloro-4-(1,3-dioxolan-2-yl)phenoxy]benzene-1,2-diamine;ethane |
| SMILES | CC.Nc1ccc(Oc2ccc(C3OCCO3)cc2Cl)cc1N |
| InChI | InChI=1S/C15H15ClN2O3.C2H6/c16-11-7-9(15-19-5-6-20-15)1-4-14(11)21-10-2-3-12(17)13(18)8-10;1-2/h1-4,7-8,15H,5-6,17-18H2;1-2H3 |
| InChIKey | QMZYFIKPLQIZRX-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.82 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|