C16H24N4O2 — CID 160672831
2-(2,5-diaminophenyl)ethanol (PubChem CID 160672831) has the molecular formula C16H24N4O2 and a molecular weight of 304.39 g/mol. Its IUPAC name is 2-(2,5-diaminophenyl)ethanol.
| Compound Name | 2-(2,5-diaminophenyl)ethanol |
|---|---|
| PubChem CID | 160672831 |
| Molecular Formula | C16H24N4O2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | 2-(2,5-diaminophenyl)ethanol |
| SMILES | Nc1ccc(N)c(CCO)c1.Nc1ccc(N)c(CCO)c1 |
| InChI | InChI=1S/2C8H12N2O/c2*9-7-1-2-8(10)6(5-7)3-4-11/h2*1-2,5,11H,3-4,9-10H2 |
| InChIKey | RNDPMHDHEZTYMO-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 144.54 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|