C15H20N4O — CID 23440231
2-[2-amino-3-[(2,5-diaminophenyl)methylamino]phenyl]ethanol (PubChem CID 23440231) has the molecular formula C15H20N4O and a molecular weight of 272.35 g/mol. Its IUPAC name is 2-[2-amino-3-[(2,5-diaminophenyl)methylamino]phenyl]ethanol.
| Compound Name | 2-[2-amino-3-[(2,5-diaminophenyl)methylamino]phenyl]ethanol |
|---|---|
| PubChem CID | 23440231 |
| Molecular Formula | C15H20N4O |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | 2-[2-amino-3-[(2,5-diaminophenyl)methylamino]phenyl]ethanol |
| SMILES | Nc1ccc(N)c(CNc2cccc(CCO)c2N)c1 |
| InChI | InChI=1S/C15H20N4O/c16-12-4-5-13(17)11(8-12)9-19-14-3-1-2-10(6-7-20)15(14)18/h1-5,8,19-20H,6-7,9,16-18H2 |
| InChIKey | BTPCTSKAWKYZKZ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 110.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|