C21H32N4O4 — CID 90754614
2-[4-amino-3-[[2-[bis(2-hydroxyethyl)amino]anilino]methyl]-N-(2-hydroxyethyl)anilino]ethanol (PubChem CID 90754614) has the molecular formula C21H32N4O4 and a molecular weight of 404.51 g/mol. Its IUPAC name is 2-[4-amino-3-[[2-[bis(2-hydroxyethyl)amino]anilino]methyl]-N-(2-hydroxyethyl)anilino]ethanol.
| Compound Name | 2-[4-amino-3-[[2-[bis(2-hydroxyethyl)amino]anilino]methyl]-N-(2-hydroxyethyl)anilino]ethanol |
|---|---|
| PubChem CID | 90754614 |
| Molecular Formula | C21H32N4O4 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.24 |
| IUPAC Name | 2-[4-amino-3-[[2-[bis(2-hydroxyethyl)amino]anilino]methyl]-N-(2-hydroxyethyl)anilino]ethanol |
| SMILES | Nc1ccc(N(CCO)CCO)cc1CNc1ccccc1N(CCO)CCO |
| InChI | InChI=1S/C21H32N4O4/c22-19-6-5-18(24(7-11-26)8-12-27)15-17(19)16-23-20-3-1-2-4-21(20)25(9-13-28)10-14-29/h1-6,15,23,26-29H,7-14,16,22H2 |
| InChIKey | OWFWRBQPIGPCAP-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 125.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|