C17H19F3N2O2 — CID 18371918
2-[4-amino-N-(2-hydroxyethyl)-3-[2-(trifluoromethyl)phenyl]anilino]ethanol (PubChem CID 18371918) has the molecular formula C17H19F3N2O2 and a molecular weight of 340.35 g/mol. Its IUPAC name is 2-[4-amino-N-(2-hydroxyethyl)-3-[2-(trifluoromethyl)phenyl]anilino]ethanol.
| Compound Name | 2-[4-amino-N-(2-hydroxyethyl)-3-[2-(trifluoromethyl)phenyl]anilino]ethanol |
|---|---|
| PubChem CID | 18371918 |
| Molecular Formula | C17H19F3N2O2 |
| Molecular Weight | 340.35 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | 2-[4-amino-N-(2-hydroxyethyl)-3-[2-(trifluoromethyl)phenyl]anilino]ethanol |
| SMILES | Nc1ccc(N(CCO)CCO)cc1-c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C17H19F3N2O2/c18-17(19,20)15-4-2-1-3-13(15)14-11-12(5-6-16(14)21)22(7-9-23)8-10-24/h1-6,11,23-24H,7-10,21H2 |
| InChIKey | BWQZZSCBRCONFC-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.35 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|