C13H13Cl2F3N2 — CID 18371370
2-[2-(trifluoromethyl)phenyl]benzene-1,4-diamine;dihydrochloride (PubChem CID 18371370) has the molecular formula C13H13Cl2F3N2 and a molecular weight of 325.16 g/mol. Its IUPAC name is 2-[2-(trifluoromethyl)phenyl]benzene-1,4-diamine;dihydrochloride.
| Compound Name | 2-[2-(trifluoromethyl)phenyl]benzene-1,4-diamine;dihydrochloride |
|---|---|
| PubChem CID | 18371370 |
| Molecular Formula | C13H13Cl2F3N2 |
| Molecular Weight | 325.16 g/mol |
| Exact Mass | 324.04 |
| IUPAC Name | 2-[2-(trifluoromethyl)phenyl]benzene-1,4-diamine;dihydrochloride |
| SMILES | Cl.Cl.Nc1ccc(N)c(-c2ccccc2C(F)(F)F)c1 |
| InChI | InChI=1S/C13H11F3N2.2ClH/c14-13(15,16)11-4-2-1-3-9(11)10-7-8(17)5-6-12(10)18;;/h1-7H,17-18H2;2*1H |
| InChIKey | WYBFVVKYMLYVTE-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.16 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|