C14H10F6N2 — CID 87519172
3-(trifluoromethyl)-4-[2-(trifluoromethyl)phenyl]benzene-1,2-diamine (PubChem CID 87519172) has the molecular formula C14H10F6N2 and a molecular weight of 320.24 g/mol. Its IUPAC name is 3-(trifluoromethyl)-4-[2-(trifluoromethyl)phenyl]benzene-1,2-diamine.
| Compound Name | 3-(trifluoromethyl)-4-[2-(trifluoromethyl)phenyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 87519172 |
| Molecular Formula | C14H10F6N2 |
| Molecular Weight | 320.24 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | 3-(trifluoromethyl)-4-[2-(trifluoromethyl)phenyl]benzene-1,2-diamine |
| SMILES | Nc1ccc(-c2ccccc2C(F)(F)F)c(C(F)(F)F)c1N |
| InChI | InChI=1S/C14H10F6N2/c15-13(16,17)9-4-2-1-3-7(9)8-5-6-10(21)12(22)11(8)14(18,19)20/h1-6H,21-22H2 |
| InChIKey | ZPSUIVIDQHHIFH-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.24 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|