C12H9F3N2O — CID 133091756
3-amino-5-[2-(trifluoromethyl)phenyl]-1H-pyridin-4-one (PubChem CID 133091756) has the molecular formula C12H9F3N2O and a molecular weight of 254.21 g/mol. Its IUPAC name is 3-amino-5-[2-(trifluoromethyl)phenyl]-1H-pyridin-4-one.
| Compound Name | 3-amino-5-[2-(trifluoromethyl)phenyl]-1H-pyridin-4-one |
|---|---|
| PubChem CID | 133091756 |
| Molecular Formula | C12H9F3N2O |
| Molecular Weight | 254.21 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | 3-amino-5-[2-(trifluoromethyl)phenyl]-1H-pyridin-4-one |
| SMILES | Nc1c[nH]cc(-c2ccccc2C(F)(F)F)c1=O |
| InChI | InChI=1S/C12H9F3N2O/c13-12(14,15)9-4-2-1-3-7(9)8-5-17-6-10(16)11(8)18/h1-6H,16H2,(H,17,18) |
| InChIKey | JOGLWOJRQNGKML-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 58.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.21 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |