About 2-[4-amino-3-(2,5-diaminophenyl)-N-(2-hydroxyethyl)anilino]ethanol
2-[4-amino-3-(2,5-diaminophenyl)-N-(2-hydroxyethyl)anilino]ethanol (PubChem CID 18371790) has the molecular formula C16H22N4O2
and a molecular weight of 302.38 g/mol. Its IUPAC name is 2-[4-amino-3-(2,5-diaminophenyl)-N-(2-hydroxyethyl)anilino]ethanol.
Molecular Properties
| Compound Name | 2-[4-amino-3-(2,5-diaminophenyl)-N-(2-hydroxyethyl)anilino]ethanol |
| PubChem CID | 18371790 |
| Molecular Formula | C16H22N4O2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | 2-[4-amino-3-(2,5-diaminophenyl)-N-(2-hydroxyethyl)anilino]ethanol |
| SMILES | Nc1ccc(N)c(-c2cc(N(CCO)CCO)ccc2N)c1 |
| InChI | InChI=1S/C16H22N4O2/c17-11-1-3-15(18)13(9-11)14-10-12(2-4-16(14)19)20(5-7-21)6-8-22/h1-4,9-10,21-22H,5-8,17-19H2 |
| InChIKey | RCDNXIUJAKSRIM-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 121.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-amino-3-(2,5-diaminophenyl)-N-(2-hydroxyethyl)anilino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-amino-3-(2,5-diaminophenyl)-N-(2-hydroxyethyl)anilino]ethanol?
The IUPAC name of 2-[4-amino-3-(2,5-diaminophenyl)-N-(2-hydroxyethyl)anilino]ethanol (CID 18371790) is 2-[4-amino-3-(2,5-diaminophenyl)-N-(2-hydroxyethyl)anilino]ethanol.
What is the SMILES notation for 2-[4-amino-3-(2,5-diaminophenyl)-N-(2-hydroxyethyl)anilino]ethanol?
The canonical SMILES for 2-[4-amino-3-(2,5-diaminophenyl)-N-(2-hydroxyethyl)anilino]ethanol is Nc1ccc(N)c(-c2cc(N(CCO)CCO)ccc2N)c1.
What is the InChIKey of 2-[4-amino-3-(2,5-diaminophenyl)-N-(2-hydroxyethyl)anilino]ethanol?
The InChIKey is RCDNXIUJAKSRIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22N4O2/c17-11-1-3-15(18)13(9-11)14-10-12(2-4-16(14)19)20(5-7-21)6-8-22/h1-4,9-10,21-22H,5-8,17-19H2.
What are the key properties of 2-[4-amino-3-(2,5-diaminophenyl)-N-(2-hydroxyethyl)anilino]ethanol?
2-[4-amino-3-(2,5-diaminophenyl)-N-(2-hydroxyethyl)anilino]ethanol has a molecular weight of 302.38 g/mol, XLogP of 0.89, 6 rotatable bonds, 5 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-amino-3-(2,5-diaminophenyl)-N-(2-hydroxyethyl)anilino]ethanol is sourced from PubChem (CID 18371790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).