C16H22N4O2 — CID 18371790
2-[4-amino-3-(2,5-diaminophenyl)-N-(2-hydroxyethyl)anilino]ethanol (PubChem CID 18371790) has the molecular formula C16H22N4O2 and a molecular weight of 302.38 g/mol. Its IUPAC name is 2-[4-amino-3-(2,5-diaminophenyl)-N-(2-hydroxyethyl)anilino]ethanol.
| Compound Name | 2-[4-amino-3-(2,5-diaminophenyl)-N-(2-hydroxyethyl)anilino]ethanol |
|---|---|
| PubChem CID | 18371790 |
| Molecular Formula | C16H22N4O2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | 2-[4-amino-3-(2,5-diaminophenyl)-N-(2-hydroxyethyl)anilino]ethanol |
| SMILES | Nc1ccc(N)c(-c2cc(N(CCO)CCO)ccc2N)c1 |
| InChI | InChI=1S/C16H22N4O2/c17-11-1-3-15(18)13(9-11)14-10-12(2-4-16(14)19)20(5-7-21)6-8-22/h1-4,9-10,21-22H,5-8,17-19H2 |
| InChIKey | RCDNXIUJAKSRIM-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 121.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|