C15H22N4O — CID 174915538
benzene-1,2-diamine;3-(2,5-diaminophenyl)propan-1-ol (PubChem CID 174915538) has the molecular formula C15H22N4O and a molecular weight of 274.37 g/mol. Its IUPAC name is benzene-1,2-diamine;3-(2,5-diaminophenyl)propan-1-ol.
| Compound Name | benzene-1,2-diamine;3-(2,5-diaminophenyl)propan-1-ol |
|---|---|
| PubChem CID | 174915538 |
| Molecular Formula | C15H22N4O |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | benzene-1,2-diamine;3-(2,5-diaminophenyl)propan-1-ol |
| SMILES | Nc1ccc(N)c(CCCO)c1.Nc1ccccc1N |
| InChI | InChI=1S/C9H14N2O.C6H8N2/c10-8-3-4-9(11)7(6-8)2-1-5-12;7-5-3-1-2-4-6(5)8/h3-4,6,12H,1-2,5,10-11H2;1-4H,7-8H2 |
| InChIKey | TYAYSLSAZHFTBN-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 124.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|