C14H23NO3 — CID 144861807
3-(2-aminophenyl)propan-1-ol;cyclopentane-1,1-diol (PubChem CID 144861807) has the molecular formula C14H23NO3 and a molecular weight of 253.34 g/mol. Its IUPAC name is 3-(2-aminophenyl)propan-1-ol;cyclopentane-1,1-diol.
| Compound Name | 3-(2-aminophenyl)propan-1-ol;cyclopentane-1,1-diol |
|---|---|
| PubChem CID | 144861807 |
| Molecular Formula | C14H23NO3 |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | 3-(2-aminophenyl)propan-1-ol;cyclopentane-1,1-diol |
| SMILES | Nc1ccccc1CCCO.OC1(O)CCCC1 |
| InChI | InChI=1S/C9H13NO.C5H10O2/c10-9-6-2-1-4-8(9)5-3-7-11;6-5(7)3-1-2-4-5/h1-2,4,6,11H,3,5,7,10H2;6-7H,1-4H2 |
| InChIKey | LHYBBPGJJGCBLQ-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|