C16H26ClNO3S — CID 144861583
S-[5-(2-chlorophenyl)pentoxy]thiohydroxylamine;cyclopentane-1,1-diol (PubChem CID 144861583) has the molecular formula C16H26ClNO3S and a molecular weight of 347.91 g/mol. Its IUPAC name is S-[5-(2-chlorophenyl)pentoxy]thiohydroxylamine;cyclopentane-1,1-diol.
| Compound Name | S-[5-(2-chlorophenyl)pentoxy]thiohydroxylamine;cyclopentane-1,1-diol |
|---|---|
| PubChem CID | 144861583 |
| Molecular Formula | C16H26ClNO3S |
| Molecular Weight | 347.91 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | S-[5-(2-chlorophenyl)pentoxy]thiohydroxylamine;cyclopentane-1,1-diol |
| SMILES | NSOCCCCCc1ccccc1Cl.OC1(O)CCCC1 |
| InChI | InChI=1S/C11H16ClNOS.C5H10O2/c12-11-8-4-3-7-10(11)6-2-1-5-9-14-15-13;6-5(7)3-1-2-4-5/h3-4,7-8H,1-2,5-6,9,13H2;6-7H,1-4H2 |
| InChIKey | WSQFVNFLPWRXGO-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.91 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|