About 2-pent-4-enylaniline
2-pent-4-enylaniline (PubChem CID 57134945) has the molecular formula C11H15N
and a molecular weight of 161.25 g/mol. Its IUPAC name is 2-pent-4-enylaniline.
Molecular Properties
| Compound Name | 2-pent-4-enylaniline |
| PubChem CID | 57134945 |
| Molecular Formula | C11H15N |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | 2-pent-4-enylaniline |
| SMILES | C=CCCCc1ccccc1N |
| InChI | InChI=1S/C11H15N/c1-2-3-4-7-10-8-5-6-9-11(10)12/h2,5-6,8-9H,1,3-4,7,12H2 |
| InChIKey | AVEFDJMFPZBQKH-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-pent-4-enylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pent-4-enylaniline?
The IUPAC name of 2-pent-4-enylaniline (CID 57134945) is 2-pent-4-enylaniline.
What is the SMILES notation for 2-pent-4-enylaniline?
The canonical SMILES for 2-pent-4-enylaniline is C=CCCCc1ccccc1N.
What is the InChIKey of 2-pent-4-enylaniline?
The InChIKey is AVEFDJMFPZBQKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N/c1-2-3-4-7-10-8-5-6-9-11(10)12/h2,5-6,8-9H,1,3-4,7,12H2.
What are the key properties of 2-pent-4-enylaniline?
2-pent-4-enylaniline has a molecular weight of 161.25 g/mol, XLogP of 2.78, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pent-4-enylaniline is sourced from PubChem (CID 57134945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).