About palladium(2+);2-prop-2-enylaniline;dichloride
palladium(2+);2-prop-2-enylaniline;dichloride (PubChem CID 3036591) has the molecular formula C9H11Cl2NPd
and a molecular weight of 310.52 g/mol. Its IUPAC name is palladium(2+);2-prop-2-enylaniline;dichloride.
Molecular Properties
| Compound Name | palladium(2+);2-prop-2-enylaniline;dichloride |
| PubChem CID | 3036591 |
| Molecular Formula | C9H11Cl2NPd |
| Molecular Weight | 310.52 g/mol |
| Exact Mass | 308.93 |
| IUPAC Name | palladium(2+);2-prop-2-enylaniline;dichloride |
| SMILES | C=CCc1ccccc1N.[Cl-].[Cl-].[Pd+2] |
| InChI | InChI=1S/C9H11N.2ClH.Pd/c1-2-5-8-6-3-4-7-9(8)10;;;/h2-4,6-7H,1,5,10H2;2*1H;/q;;;+2/p-2 |
| InChIKey | LZUNJDCKTYQPRE-UHFFFAOYSA-L |
| XLogP | -4.00 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.52 |
| LogP ≤ 5 | -4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze palladium(2+);2-prop-2-enylaniline;dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of palladium(2+);2-prop-2-enylaniline;dichloride?
The IUPAC name of palladium(2+);2-prop-2-enylaniline;dichloride (CID 3036591) is palladium(2+);2-prop-2-enylaniline;dichloride.
What is the SMILES notation for palladium(2+);2-prop-2-enylaniline;dichloride?
The canonical SMILES for palladium(2+);2-prop-2-enylaniline;dichloride is C=CCc1ccccc1N.[Cl-].[Cl-].[Pd+2].
What is the InChIKey of palladium(2+);2-prop-2-enylaniline;dichloride?
The InChIKey is LZUNJDCKTYQPRE-UHFFFAOYSA-L. The full InChI is InChI=1S/C9H11N.2ClH.Pd/c1-2-5-8-6-3-4-7-9(8)10;;;/h2-4,6-7H,1,5,10H2;2*1H;/q;;;+2/p-2.
What are the key properties of palladium(2+);2-prop-2-enylaniline;dichloride?
palladium(2+);2-prop-2-enylaniline;dichloride has a molecular weight of 310.52 g/mol, XLogP of -4.00, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for palladium(2+);2-prop-2-enylaniline;dichloride is sourced from PubChem (CID 3036591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).