About 2-prop-2-enylaniline;yttrium
2-prop-2-enylaniline;yttrium (PubChem CID 58219768) has the molecular formula C9H10NY-
and a molecular weight of 221.09 g/mol. Its IUPAC name is 2-prop-2-enylaniline;yttrium.
Molecular Properties
| Compound Name | 2-prop-2-enylaniline;yttrium |
| PubChem CID | 58219768 |
| Molecular Formula | C9H10NY- |
| Molecular Weight | 221.09 g/mol |
| Exact Mass | 220.99 |
| IUPAC Name | 2-prop-2-enylaniline;yttrium |
| SMILES | [H]/[C-]=C\Cc1ccccc1N.[Y] |
| InChI | InChI=1S/C9H10N.Y/c1-2-5-8-6-3-4-7-9(8)10;/h1-4,6-7H,5,10H2;/q-1; |
| InChIKey | NHBFQQHJODPFPD-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.09 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2-prop-2-enylaniline;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-prop-2-enylaniline;yttrium?
The IUPAC name of 2-prop-2-enylaniline;yttrium (CID 58219768) is 2-prop-2-enylaniline;yttrium.
What is the SMILES notation for 2-prop-2-enylaniline;yttrium?
The canonical SMILES for 2-prop-2-enylaniline;yttrium is [H]/[C-]=C\Cc1ccccc1N.[Y].
What is the InChIKey of 2-prop-2-enylaniline;yttrium?
The InChIKey is NHBFQQHJODPFPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N.Y/c1-2-5-8-6-3-4-7-9(8)10;/h1-4,6-7H,5,10H2;/q-1;.
What are the key properties of 2-prop-2-enylaniline;yttrium?
2-prop-2-enylaniline;yttrium has a molecular weight of 221.09 g/mol, XLogP of 1.80, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-prop-2-enylaniline;yttrium is sourced from PubChem (CID 58219768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).