C14H20N3+ — CID 168720542
2-[3-(1-methylpyrrol-1-ium-1-yl)propyl]benzene-1,4-diamine (PubChem CID 168720542) has the molecular formula C14H20N3+ and a molecular weight of 230.33 g/mol. Its IUPAC name is 2-[3-(1-methylpyrrol-1-ium-1-yl)propyl]benzene-1,4-diamine.
| Compound Name | 2-[3-(1-methylpyrrol-1-ium-1-yl)propyl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 168720542 |
| Molecular Formula | C14H20N3+ |
| Molecular Weight | 230.33 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | 2-[3-(1-methylpyrrol-1-ium-1-yl)propyl]benzene-1,4-diamine |
| SMILES | C[N+]1(CCCc2cc(N)ccc2N)C=CC=C1 |
| InChI | InChI=1S/C14H20N3/c1-17(8-2-3-9-17)10-4-5-12-11-13(15)6-7-14(12)16/h2-3,6-9,11H,4-5,10,15-16H2,1H3/q+1 |
| InChIKey | CTLWSZWLCRDXSQ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.33 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|