C13H16N4O — CID 57055937
2-[(2,4-diaminophenoxy)methyl]benzene-1,4-diamine (PubChem CID 57055937) has the molecular formula C13H16N4O and a molecular weight of 244.30 g/mol. Its IUPAC name is 2-[(2,4-diaminophenoxy)methyl]benzene-1,4-diamine.
| Compound Name | 2-[(2,4-diaminophenoxy)methyl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 57055937 |
| Molecular Formula | C13H16N4O |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 2-[(2,4-diaminophenoxy)methyl]benzene-1,4-diamine |
| SMILES | Nc1ccc(OCc2cc(N)ccc2N)c(N)c1 |
| InChI | InChI=1S/C13H16N4O/c14-9-1-3-11(16)8(5-9)7-18-13-4-2-10(15)6-12(13)17/h1-6H,7,14-17H2 |
| InChIKey | RXQNAKOCSLTQAO-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 113.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|