C13H13FN2O — CID 142729124
4-[(2-fluorophenyl)methoxy]benzene-1,3-diamine (PubChem CID 142729124) has the molecular formula C13H13FN2O and a molecular weight of 232.26 g/mol. Its IUPAC name is 4-[(2-fluorophenyl)methoxy]benzene-1,3-diamine.
| Compound Name | 4-[(2-fluorophenyl)methoxy]benzene-1,3-diamine |
|---|---|
| PubChem CID | 142729124 |
| Molecular Formula | C13H13FN2O |
| Molecular Weight | 232.26 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | 4-[(2-fluorophenyl)methoxy]benzene-1,3-diamine |
| SMILES | Nc1ccc(OCc2ccccc2F)c(N)c1 |
| InChI | InChI=1S/C13H13FN2O/c14-11-4-2-1-3-9(11)8-17-13-6-5-10(15)7-12(13)16/h1-7H,8,15-16H2 |
| InChIKey | HRUYQQXRFXXANY-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.26 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|