C21H22N2O — CID 58289288
2-[[4-(4-ethylphenyl)phenoxy]methyl]benzene-1,4-diamine (PubChem CID 58289288) has the molecular formula C21H22N2O and a molecular weight of 318.42 g/mol. Its IUPAC name is 2-[[4-(4-ethylphenyl)phenoxy]methyl]benzene-1,4-diamine.
| Compound Name | 2-[[4-(4-ethylphenyl)phenoxy]methyl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 58289288 |
| Molecular Formula | C21H22N2O |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | 2-[[4-(4-ethylphenyl)phenoxy]methyl]benzene-1,4-diamine |
| SMILES | CCc1ccc(-c2ccc(OCc3cc(N)ccc3N)cc2)cc1 |
| InChI | InChI=1S/C21H22N2O/c1-2-15-3-5-16(6-4-15)17-7-10-20(11-8-17)24-14-18-13-19(22)9-12-21(18)23/h3-13H,2,14,22-23H2,1H3 |
| InChIKey | ZVNNAMSKWJWOGD-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|