About 4-[4-[(4-aminophenoxy)methyl]phenyl]aniline;ethane;formic acid
4-[4-[(4-aminophenoxy)methyl]phenyl]aniline;ethane;formic acid (PubChem CID 145159200) has the molecular formula C22H26N2O3
and a molecular weight of 366.46 g/mol. Its IUPAC name is 4-[4-[(4-aminophenoxy)methyl]phenyl]aniline;ethane;formic acid.
Molecular Properties
| Compound Name | 4-[4-[(4-aminophenoxy)methyl]phenyl]aniline;ethane;formic acid |
| PubChem CID | 145159200 |
| Molecular Formula | C22H26N2O3 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | 4-[4-[(4-aminophenoxy)methyl]phenyl]aniline;ethane;formic acid |
| SMILES | CC.Nc1ccc(OCc2ccc(-c3ccc(N)cc3)cc2)cc1.O=CO |
| InChI | InChI=1S/C19H18N2O.C2H6.CH2O2/c20-17-7-5-16(6-8-17)15-3-1-14(2-4-15)13-22-19-11-9-18(21)10-12-19;1-2;2-1-3/h1-12H,13,20-21H2;1-2H3;1H,(H,2,3) |
| InChIKey | SKIDSNKHIZUAEA-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 98.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-[4-[(4-aminophenoxy)methyl]phenyl]aniline;ethane;formic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-[(4-aminophenoxy)methyl]phenyl]aniline;ethane;formic acid?
The IUPAC name of 4-[4-[(4-aminophenoxy)methyl]phenyl]aniline;ethane;formic acid (CID 145159200) is 4-[4-[(4-aminophenoxy)methyl]phenyl]aniline;ethane;formic acid.
What is the SMILES notation for 4-[4-[(4-aminophenoxy)methyl]phenyl]aniline;ethane;formic acid?
The canonical SMILES for 4-[4-[(4-aminophenoxy)methyl]phenyl]aniline;ethane;formic acid is CC.Nc1ccc(OCc2ccc(-c3ccc(N)cc3)cc2)cc1.O=CO.
What is the InChIKey of 4-[4-[(4-aminophenoxy)methyl]phenyl]aniline;ethane;formic acid?
The InChIKey is SKIDSNKHIZUAEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18N2O.C2H6.CH2O2/c20-17-7-5-16(6-8-17)15-3-1-14(2-4-15)13-22-19-11-9-18(21)10-12-19;1-2;2-1-3/h1-12H,13,20-21H2;1-2H3;1H,(H,2,3).
What are the key properties of 4-[4-[(4-aminophenoxy)methyl]phenyl]aniline;ethane;formic acid?
4-[4-[(4-aminophenoxy)methyl]phenyl]aniline;ethane;formic acid has a molecular weight of 366.46 g/mol, XLogP of 4.82, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-[(4-aminophenoxy)methyl]phenyl]aniline;ethane;formic acid is sourced from PubChem (CID 145159200), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).