About ethane;molecular hydrogen;4-phenylmethoxyaniline
ethane;molecular hydrogen;4-phenylmethoxyaniline (PubChem CID 142075027) has the molecular formula C15H21NO
and a molecular weight of 231.34 g/mol. Its IUPAC name is ethane;molecular hydrogen;4-phenylmethoxyaniline.
Molecular Properties
| Compound Name | ethane;molecular hydrogen;4-phenylmethoxyaniline |
| PubChem CID | 142075027 |
| Molecular Formula | C15H21NO |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | ethane;molecular hydrogen;4-phenylmethoxyaniline |
| SMILES | CC.Nc1ccc(OCc2ccccc2)cc1.[H][H] |
| InChI | InChI=1S/C13H13NO.C2H6.H2/c14-12-6-8-13(9-7-12)15-10-11-4-2-1-3-5-11;1-2;/h1-9H,10,14H2;1-2H3;1H |
| InChIKey | XAWZODDHIOHDCD-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze ethane;molecular hydrogen;4-phenylmethoxyaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;molecular hydrogen;4-phenylmethoxyaniline?
The IUPAC name of ethane;molecular hydrogen;4-phenylmethoxyaniline (CID 142075027) is ethane;molecular hydrogen;4-phenylmethoxyaniline.
What is the SMILES notation for ethane;molecular hydrogen;4-phenylmethoxyaniline?
The canonical SMILES for ethane;molecular hydrogen;4-phenylmethoxyaniline is CC.Nc1ccc(OCc2ccccc2)cc1.[H][H].
What is the InChIKey of ethane;molecular hydrogen;4-phenylmethoxyaniline?
The InChIKey is XAWZODDHIOHDCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO.C2H6.H2/c14-12-6-8-13(9-7-12)15-10-11-4-2-1-3-5-11;1-2;/h1-9H,10,14H2;1-2H3;1H.
What are the key properties of ethane;molecular hydrogen;4-phenylmethoxyaniline?
ethane;molecular hydrogen;4-phenylmethoxyaniline has a molecular weight of 231.34 g/mol, XLogP of 4.12, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;molecular hydrogen;4-phenylmethoxyaniline is sourced from PubChem (CID 142075027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).