About 4-ethoxyaniline;phenylmethanamine
4-ethoxyaniline;phenylmethanamine (PubChem CID 172737441) has the molecular formula C15H20N2O
and a molecular weight of 244.34 g/mol. Its IUPAC name is 4-ethoxyaniline;phenylmethanamine.
Molecular Properties
| Compound Name | 4-ethoxyaniline;phenylmethanamine |
| PubChem CID | 172737441 |
| Molecular Formula | C15H20N2O |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | 4-ethoxyaniline;phenylmethanamine |
| SMILES | CCOc1ccc(N)cc1.NCc1ccccc1 |
| InChI | InChI=1S/C8H11NO.C7H9N/c1-2-10-8-5-3-7(9)4-6-8;8-6-7-4-2-1-3-5-7/h3-6H,2,9H2,1H3;1-5H,6,8H2 |
| InChIKey | IQDGCKLVBZKHHI-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-ethoxyaniline;phenylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethoxyaniline;phenylmethanamine?
The IUPAC name of 4-ethoxyaniline;phenylmethanamine (CID 172737441) is 4-ethoxyaniline;phenylmethanamine.
What is the SMILES notation for 4-ethoxyaniline;phenylmethanamine?
The canonical SMILES for 4-ethoxyaniline;phenylmethanamine is CCOc1ccc(N)cc1.NCc1ccccc1.
What is the InChIKey of 4-ethoxyaniline;phenylmethanamine?
The InChIKey is IQDGCKLVBZKHHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO.C7H9N/c1-2-10-8-5-3-7(9)4-6-8;8-6-7-4-2-1-3-5-7/h3-6H,2,9H2,1H3;1-5H,6,8H2.
What are the key properties of 4-ethoxyaniline;phenylmethanamine?
4-ethoxyaniline;phenylmethanamine has a molecular weight of 244.34 g/mol, XLogP of 2.81, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethoxyaniline;phenylmethanamine is sourced from PubChem (CID 172737441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).