About 4-ethoxyaniline;2-ethylphenol
4-ethoxyaniline;2-ethylphenol (PubChem CID 174728070) has the molecular formula C16H21NO2
and a molecular weight of 259.35 g/mol. Its IUPAC name is 4-ethoxyaniline;2-ethylphenol.
Molecular Properties
| Compound Name | 4-ethoxyaniline;2-ethylphenol |
| PubChem CID | 174728070 |
| Molecular Formula | C16H21NO2 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | 4-ethoxyaniline;2-ethylphenol |
| SMILES | CCOc1ccc(N)cc1.CCc1ccccc1O |
| InChI | InChI=1S/C8H11NO.C8H10O/c1-2-10-8-5-3-7(9)4-6-8;1-2-7-5-3-4-6-8(7)9/h3-6H,2,9H2,1H3;3-6,9H,2H2,1H3 |
| InChIKey | QVJCRHIDBQPFCA-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-ethoxyaniline;2-ethylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethoxyaniline;2-ethylphenol?
The IUPAC name of 4-ethoxyaniline;2-ethylphenol (CID 174728070) is 4-ethoxyaniline;2-ethylphenol.
What is the SMILES notation for 4-ethoxyaniline;2-ethylphenol?
The canonical SMILES for 4-ethoxyaniline;2-ethylphenol is CCOc1ccc(N)cc1.CCc1ccccc1O.
What is the InChIKey of 4-ethoxyaniline;2-ethylphenol?
The InChIKey is QVJCRHIDBQPFCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO.C8H10O/c1-2-10-8-5-3-7(9)4-6-8;1-2-7-5-3-4-6-8(7)9/h3-6H,2,9H2,1H3;3-6,9H,2H2,1H3.
What are the key properties of 4-ethoxyaniline;2-ethylphenol?
4-ethoxyaniline;2-ethylphenol has a molecular weight of 259.35 g/mol, XLogP of 3.62, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethoxyaniline;2-ethylphenol is sourced from PubChem (CID 174728070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).