C12H18N2 — CID 173339882
4-[(E)-hex-4-enyl]benzene-1,3-diamine (PubChem CID 173339882) has the molecular formula C12H18N2 and a molecular weight of 190.29 g/mol. Its IUPAC name is 4-[(E)-hex-4-enyl]benzene-1,3-diamine.
| Compound Name | 4-[(E)-hex-4-enyl]benzene-1,3-diamine |
|---|---|
| PubChem CID | 173339882 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | 4-[(E)-hex-4-enyl]benzene-1,3-diamine |
| SMILES | C/C=C/CCCc1ccc(N)cc1N |
| InChI | InChI=1S/C12H18N2/c1-2-3-4-5-6-10-7-8-11(13)9-12(10)14/h2-3,7-9H,4-6,13-14H2,1H3/b3-2+ |
| InChIKey | HKHXRCQORHWUSU-NSCUHMNNSA-N |
| XLogP | 2.75 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|