About 5-ethyl-2-hexylaniline
5-ethyl-2-hexylaniline (PubChem CID 22065589) has the molecular formula C14H23N
and a molecular weight of 205.34 g/mol. Its IUPAC name is 5-ethyl-2-hexylaniline.
Molecular Properties
| Compound Name | 5-ethyl-2-hexylaniline |
| PubChem CID | 22065589 |
| Molecular Formula | C14H23N |
| Molecular Weight | 205.34 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | 5-ethyl-2-hexylaniline |
| SMILES | CCCCCCc1ccc(CC)cc1N |
| InChI | InChI=1S/C14H23N/c1-3-5-6-7-8-13-10-9-12(4-2)11-14(13)15/h9-11H,3-8,15H2,1-2H3 |
| InChIKey | SDLWOXRMKUQVEJ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.34 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-ethyl-2-hexylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-2-hexylaniline?
The IUPAC name of 5-ethyl-2-hexylaniline (CID 22065589) is 5-ethyl-2-hexylaniline.
What is the SMILES notation for 5-ethyl-2-hexylaniline?
The canonical SMILES for 5-ethyl-2-hexylaniline is CCCCCCc1ccc(CC)cc1N.
What is the InChIKey of 5-ethyl-2-hexylaniline?
The InChIKey is SDLWOXRMKUQVEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23N/c1-3-5-6-7-8-13-10-9-12(4-2)11-14(13)15/h9-11H,3-8,15H2,1-2H3.
What are the key properties of 5-ethyl-2-hexylaniline?
5-ethyl-2-hexylaniline has a molecular weight of 205.34 g/mol, XLogP of 3.95, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-2-hexylaniline is sourced from PubChem (CID 22065589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).