C14H18Cl2N2 — CID 68567088
4-(2-phenylethyl)benzene-1,3-diamine;dihydrochloride (PubChem CID 68567088) has the molecular formula C14H18Cl2N2 and a molecular weight of 285.22 g/mol. Its IUPAC name is 4-(2-phenylethyl)benzene-1,3-diamine;dihydrochloride.
| Compound Name | 4-(2-phenylethyl)benzene-1,3-diamine;dihydrochloride |
|---|---|
| PubChem CID | 68567088 |
| Molecular Formula | C14H18Cl2N2 |
| Molecular Weight | 285.22 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 4-(2-phenylethyl)benzene-1,3-diamine;dihydrochloride |
| SMILES | Cl.Cl.Nc1ccc(CCc2ccccc2)c(N)c1 |
| InChI | InChI=1S/C14H16N2.2ClH/c15-13-9-8-12(14(16)10-13)7-6-11-4-2-1-3-5-11;;/h1-5,8-10H,6-7,15-16H2;2*1H |
| InChIKey | XTIDIEZUCAZQDE-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.22 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|