C22H24N2O — CID 159406266
2-phenylethanol;4-(2-phenylethenyl)benzene-1,3-diamine (PubChem CID 159406266) has the molecular formula C22H24N2O and a molecular weight of 332.45 g/mol. Its IUPAC name is 2-phenylethanol;4-(2-phenylethenyl)benzene-1,3-diamine.
| Compound Name | 2-phenylethanol;4-(2-phenylethenyl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 159406266 |
| Molecular Formula | C22H24N2O |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.19 |
| IUPAC Name | 2-phenylethanol;4-(2-phenylethenyl)benzene-1,3-diamine |
| SMILES | Nc1ccc(C=Cc2ccccc2)c(N)c1.OCCc1ccccc1 |
| InChI | InChI=1S/C14H14N2.C8H10O/c15-13-9-8-12(14(16)10-13)7-6-11-4-2-1-3-5-11;9-7-6-8-4-2-1-3-5-8/h1-10H,15-16H2;1-5,9H,6-7H2 |
| InChIKey | LNZLDMYMWMDMCB-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|