C17H22N2O — CID 174558761
3-(2-phenylethenyl)benzene-1,2-diamine;propan-1-ol (PubChem CID 174558761) has the molecular formula C17H22N2O and a molecular weight of 270.38 g/mol. Its IUPAC name is 3-(2-phenylethenyl)benzene-1,2-diamine;propan-1-ol.
| Compound Name | 3-(2-phenylethenyl)benzene-1,2-diamine;propan-1-ol |
|---|---|
| PubChem CID | 174558761 |
| Molecular Formula | C17H22N2O |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | 3-(2-phenylethenyl)benzene-1,2-diamine;propan-1-ol |
| SMILES | CCCO.Nc1cccc(C=Cc2ccccc2)c1N |
| InChI | InChI=1S/C14H14N2.C3H8O/c15-13-8-4-7-12(14(13)16)10-9-11-5-2-1-3-6-11;1-2-3-4/h1-10H,15-16H2;4H,2-3H2,1H3 |
| InChIKey | WXUUGFQXVWOXNE-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|