C9H10N2O2 — CID 169460294
3-(2,3-diaminophenyl)prop-2-enoic acid (PubChem CID 169460294) has the molecular formula C9H10N2O2 and a molecular weight of 178.19 g/mol. Its IUPAC name is 3-(2,3-diaminophenyl)prop-2-enoic acid.
| Compound Name | 3-(2,3-diaminophenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 169460294 |
| Molecular Formula | C9H10N2O2 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | 3-(2,3-diaminophenyl)prop-2-enoic acid |
| SMILES | Nc1cccc(C=CC(=O)O)c1N |
| InChI | InChI=1S/C9H10N2O2/c10-7-3-1-2-6(9(7)11)4-5-8(12)13/h1-5H,10-11H2,(H,12,13) |
| InChIKey | UXSRMRJYBRVCEB-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 89.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|