C14H16N4 — CID 70561484
3-[(E)-2-(2,3-diaminophenyl)ethenyl]benzene-1,2-diamine (PubChem CID 70561484) has the molecular formula C14H16N4 and a molecular weight of 240.31 g/mol. Its IUPAC name is 3-[(E)-2-(2,3-diaminophenyl)ethenyl]benzene-1,2-diamine.
| Compound Name | 3-[(E)-2-(2,3-diaminophenyl)ethenyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 70561484 |
| Molecular Formula | C14H16N4 |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 3-[(E)-2-(2,3-diaminophenyl)ethenyl]benzene-1,2-diamine |
| SMILES | Nc1cccc(/C=C/c2cccc(N)c2N)c1N |
| InChI | InChI=1S/C14H16N4/c15-11-5-1-3-9(13(11)17)7-8-10-4-2-6-12(16)14(10)18/h1-8H,15-18H2/b8-7+ |
| InChIKey | DCKQRHOYGDPVTD-BQYQJAHWSA-N |
| XLogP | 2.19 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|