C22H18Cl2N2 — CID 70478273
2-[(E)-2-[4-[(E)-2-(2-aminophenyl)ethenyl]-2,5-dichlorophenyl]ethenyl]aniline (PubChem CID 70478273) has the molecular formula C22H18Cl2N2 and a molecular weight of 381.31 g/mol. Its IUPAC name is 2-[(E)-2-[4-[(E)-2-(2-aminophenyl)ethenyl]-2,5-dichlorophenyl]ethenyl]aniline.
| Compound Name | 2-[(E)-2-[4-[(E)-2-(2-aminophenyl)ethenyl]-2,5-dichlorophenyl]ethenyl]aniline |
|---|---|
| PubChem CID | 70478273 |
| Molecular Formula | C22H18Cl2N2 |
| Molecular Weight | 381.31 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | 2-[(E)-2-[4-[(E)-2-(2-aminophenyl)ethenyl]-2,5-dichlorophenyl]ethenyl]aniline |
| SMILES | Nc1ccccc1/C=C/c1cc(Cl)c(/C=C/c2ccccc2N)cc1Cl |
| InChI | InChI=1S/C22H18Cl2N2/c23-19-14-18(12-10-16-6-2-4-8-22(16)26)20(24)13-17(19)11-9-15-5-1-3-7-21(15)25/h1-14H,25-26H2/b11-9+,12-10+ |
| InChIKey | CWDRBYFOYLYAPG-WGDLNXRISA-N |
| XLogP | 6.50 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.31 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|