C24H22O2 — CID 162493938
2-[2,3-bis[(E)-2-phenylethenyl]phenoxy]ethanol (PubChem CID 162493938) has the molecular formula C24H22O2 and a molecular weight of 342.44 g/mol. Its IUPAC name is 2-[2,3-bis[(E)-2-phenylethenyl]phenoxy]ethanol.
| Compound Name | 2-[2,3-bis[(E)-2-phenylethenyl]phenoxy]ethanol |
|---|---|
| PubChem CID | 162493938 |
| Molecular Formula | C24H22O2 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | 2-[2,3-bis[(E)-2-phenylethenyl]phenoxy]ethanol |
| SMILES | OCCOc1cccc(/C=C/c2ccccc2)c1/C=C/c1ccccc1 |
| InChI | InChI=1S/C24H22O2/c25-18-19-26-24-13-7-12-22(16-14-20-8-3-1-4-9-20)23(24)17-15-21-10-5-2-6-11-21/h1-17,25H,18-19H2/b16-14+,17-15+ |
| InChIKey | YZYPIGMZFFBOKZ-YXLFCKQPSA-N |
| XLogP | 5.40 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|