C17H19NO — CID 20555192
3-[2-[(E)-2-phenylethenyl]phenoxy]propan-1-amine (PubChem CID 20555192) has the molecular formula C17H19NO and a molecular weight of 253.35 g/mol. Its IUPAC name is 3-[2-[(E)-2-phenylethenyl]phenoxy]propan-1-amine.
| Compound Name | 3-[2-[(E)-2-phenylethenyl]phenoxy]propan-1-amine |
|---|---|
| PubChem CID | 20555192 |
| Molecular Formula | C17H19NO |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | 3-[2-[(E)-2-phenylethenyl]phenoxy]propan-1-amine |
| SMILES | NCCCOc1ccccc1/C=C/c1ccccc1 |
| InChI | InChI=1S/C17H19NO/c18-13-6-14-19-17-10-5-4-9-16(17)12-11-15-7-2-1-3-8-15/h1-5,7-12H,6,13-14,18H2/b12-11+ |
| InChIKey | PXWURKILYHZAII-VAWYXSNFSA-N |
| XLogP | 3.58 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|