C13H18ClNO3 — CID 117432338
4-(4-aminobutan-2-yl)-6-chloro-2,3-dimethoxybenzaldehyde (PubChem CID 117432338) has the molecular formula C13H18ClNO3 and a molecular weight of 271.74 g/mol. Its IUPAC name is 4-(4-aminobutan-2-yl)-6-chloro-2,3-dimethoxybenzaldehyde.
| Compound Name | 4-(4-aminobutan-2-yl)-6-chloro-2,3-dimethoxybenzaldehyde |
|---|---|
| PubChem CID | 117432338 |
| Molecular Formula | C13H18ClNO3 |
| Molecular Weight | 271.74 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 4-(4-aminobutan-2-yl)-6-chloro-2,3-dimethoxybenzaldehyde |
| SMILES | COc1c(C(C)CCN)cc(Cl)c(C=O)c1OC |
| InChI | InChI=1S/C13H18ClNO3/c1-8(4-5-15)9-6-11(14)10(7-16)13(18-3)12(9)17-2/h6-8H,4-5,15H2,1-3H3 |
| InChIKey | XYVKPTMVMCIEIH-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.74 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|