C11H11ClO4 — CID 84703434
4-acetyl-6-chloro-2,3-dimethoxybenzaldehyde (PubChem CID 84703434) has the molecular formula C11H11ClO4 and a molecular weight of 242.66 g/mol. Its IUPAC name is 4-acetyl-6-chloro-2,3-dimethoxybenzaldehyde.
| Compound Name | 4-acetyl-6-chloro-2,3-dimethoxybenzaldehyde |
|---|---|
| PubChem CID | 84703434 |
| Molecular Formula | C11H11ClO4 |
| Molecular Weight | 242.66 g/mol |
| Exact Mass | 242.03 |
| IUPAC Name | 4-acetyl-6-chloro-2,3-dimethoxybenzaldehyde |
| SMILES | COc1c(C(C)=O)cc(Cl)c(C=O)c1OC |
| InChI | InChI=1S/C11H11ClO4/c1-6(14)7-4-9(12)8(5-13)11(16-3)10(7)15-2/h4-5H,1-3H3 |
| InChIKey | OAOKXYGNDMKDTO-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.66 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|