C10H11ClO3 — CID 84680566
1-(4-chloro-2,3-dimethoxyphenyl)ethanone (PubChem CID 84680566) has the molecular formula C10H11ClO3 and a molecular weight of 214.65 g/mol. Its IUPAC name is 1-(4-chloro-2,3-dimethoxyphenyl)ethanone.
| Compound Name | 1-(4-chloro-2,3-dimethoxyphenyl)ethanone |
|---|---|
| PubChem CID | 84680566 |
| Molecular Formula | C10H11ClO3 |
| Molecular Weight | 214.65 g/mol |
| Exact Mass | 214.04 |
| IUPAC Name | 1-(4-chloro-2,3-dimethoxyphenyl)ethanone |
| SMILES | COc1c(Cl)ccc(C(C)=O)c1OC |
| InChI | InChI=1S/C10H11ClO3/c1-6(12)7-4-5-8(11)10(14-3)9(7)13-2/h4-5H,1-3H3 |
| InChIKey | FYWXTQDRWZOYEW-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.65 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |