C8H9ClFNO3 — CID 84788284
4-(1-amino-2-hydroxyethyl)-2-chloro-6-fluorobenzene-1,3-diol (PubChem CID 84788284) has the molecular formula C8H9ClFNO3 and a molecular weight of 221.61 g/mol. Its IUPAC name is 4-(1-amino-2-hydroxyethyl)-2-chloro-6-fluorobenzene-1,3-diol.
| Compound Name | 4-(1-amino-2-hydroxyethyl)-2-chloro-6-fluorobenzene-1,3-diol |
|---|---|
| PubChem CID | 84788284 |
| Molecular Formula | C8H9ClFNO3 |
| Molecular Weight | 221.61 g/mol |
| Exact Mass | 221.03 |
| IUPAC Name | 4-(1-amino-2-hydroxyethyl)-2-chloro-6-fluorobenzene-1,3-diol |
| SMILES | NC(CO)c1cc(F)c(O)c(Cl)c1O |
| InChI | InChI=1S/C8H9ClFNO3/c9-6-7(13)3(5(11)2-12)1-4(10)8(6)14/h1,5,12-14H,2,11H2 |
| InChIKey | PEAPUUAJIYJFLE-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.61 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|