C11H10Cl3NS — CID 171202537
(S)-(3,5-dichlorophenyl)-thiophen-2-ylmethanamine;hydrochloride (PubChem CID 171202537) has the molecular formula C11H10Cl3NS and a molecular weight of 294.63 g/mol. Its IUPAC name is (S)-(3,5-dichlorophenyl)-thiophen-2-ylmethanamine;hydrochloride.
| Compound Name | (S)-(3,5-dichlorophenyl)-thiophen-2-ylmethanamine;hydrochloride |
|---|---|
| PubChem CID | 171202537 |
| Molecular Formula | C11H10Cl3NS |
| Molecular Weight | 294.63 g/mol |
| Exact Mass | 292.96 |
| IUPAC Name | (S)-(3,5-dichlorophenyl)-thiophen-2-ylmethanamine;hydrochloride |
| SMILES | Cl.N[C@@H](c1cc(Cl)cc(Cl)c1)c1cccs1 |
| InChI | InChI=1S/C11H9Cl2NS.ClH/c12-8-4-7(5-9(13)6-8)11(14)10-2-1-3-15-10;/h1-6,11H,14H2;1H/t11-;/m0./s1 |
| InChIKey | RFTOCMFNNWBSAL-MERQFXBCSA-N |
| XLogP | 4.52 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.63 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |