C19H19ClN4O8S2 — CID 57229207
(6S,7R)-3-(acetyloxymethyl)-7-[[2-(2-chloroethylcarbamoyloxyimino)-2-thiophen-2-ylacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 57229207) has the molecular formula C19H19ClN4O8S2 and a molecular weight of 530.97 g/mol. Its IUPAC name is (6S,7R)-3-(acetyloxymethyl)-7-[[2-(2-chloroethylcarbamoyloxyimino)-2-thiophen-2-ylacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6S,7R)-3-(acetyloxymethyl)-7-[[2-(2-chloroethylcarbamoyloxyimino)-2-thiophen-2-ylacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 57229207 |
| Molecular Formula | C19H19ClN4O8S2 |
| Molecular Weight | 530.97 g/mol |
| Exact Mass | 530.03 |
| IUPAC Name | (6S,7R)-3-(acetyloxymethyl)-7-[[2-(2-chloroethylcarbamoyloxyimino)-2-thiophen-2-ylacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CC(=O)OCC1=C(C(=O)O)N2C(=O)[C@@H](NC(=O)C(=NOC(=O)NCCCl)c3cccs3)[C@@H]2SC1 |
| InChI | InChI=1S/C19H19ClN4O8S2/c1-9(25)31-7-10-8-34-17-13(16(27)24(17)14(10)18(28)29)22-15(26)12(11-3-2-6-33-11)23-32-19(30)21-5-4-20/h2-3,6,13,17H,4-5,7-8H2,1H3,(H,21,30)(H,22,26)(H,28,29)/t13-,17+/m1/s1 |
| InChIKey | GLPUCJNWLCPHDN-DYVFJYSZSA-N |
| XLogP | 0.72 |
| TPSA | 163.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.97 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|