C18H19N3O8S2 — CID 154411781
(6R,7R)-3-(acetyloxymethyl)-7-[[2-(methoxymethoxyimino)-2-thiophen-2-ylacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 154411781) has the molecular formula C18H19N3O8S2 and a molecular weight of 469.50 g/mol. Its IUPAC name is (6R,7R)-3-(acetyloxymethyl)-7-[[2-(methoxymethoxyimino)-2-thiophen-2-ylacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R,7R)-3-(acetyloxymethyl)-7-[[2-(methoxymethoxyimino)-2-thiophen-2-ylacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 154411781 |
| Molecular Formula | C18H19N3O8S2 |
| Molecular Weight | 469.50 g/mol |
| Exact Mass | 469.06 |
| IUPAC Name | (6R,7R)-3-(acetyloxymethyl)-7-[[2-(methoxymethoxyimino)-2-thiophen-2-ylacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | COCON=C(C(=O)N[C@@H]1C(=O)N2C(C(=O)O)=C(COC(C)=O)CS[C@H]12)c1cccs1 |
| InChI | InChI=1S/C18H19N3O8S2/c1-9(22)28-6-10-7-31-17-13(16(24)21(17)14(10)18(25)26)19-15(23)12(20-29-8-27-2)11-4-3-5-30-11/h3-5,13,17H,6-8H2,1-2H3,(H,19,23)(H,25,26)/t13-,17-/m1/s1 |
| InChIKey | FPUKPQNUDCRMAY-CXAGYDPISA-N |
| XLogP | 0.37 |
| TPSA | 143.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.50 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|